About (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole
(4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole (PubChem CID 144957614) has the molecular formula C19H28N6O2
and a molecular weight of 372.47 g/mol. Its IUPAC name is (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole.
Molecular Properties
| Compound Name | (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole |
| PubChem CID | 144957614 |
| Molecular Formula | C19H28N6O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole |
| SMILES | Cc1ccc(-c2cn[nH]c2)cc1.N/N=C(/CC(C(=O)O)C1CCCC1)NN |
| InChI | InChI=1S/C10H10N2.C9H18N4O2/c1-8-2-4-9(5-3-8)10-6-11-12-7-10;10-12-8(13-11)5-7(9(14)15)6-3-1-2-4-6/h2-7H,1H3,(H,11,12);6-7H,1-5,10-11H2,(H,12,13)(H,14,15) |
| InChIKey | ISGQANBBGUMQCB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 142.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole?
The IUPAC name of (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole (CID 144957614) is (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole.
What is the SMILES notation for (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole?
The canonical SMILES for (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole is Cc1ccc(-c2cn[nH]c2)cc1.N/N=C(/CC(C(=O)O)C1CCCC1)NN.
What is the InChIKey of (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole?
The InChIKey is ISGQANBBGUMQCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C9H18N4O2/c1-8-2-4-9(5-3-8)10-6-11-12-7-10;10-12-8(13-11)5-7(9(14)15)6-3-1-2-4-6/h2-7H,1H3,(H,11,12);6-7H,1-5,10-11H2,(H,12,13)(H,14,15).
What are the key properties of (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole?
(4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole has a molecular weight of 372.47 g/mol, XLogP of 2.39, 5 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-cyclopentyl-4-hydrazinyl-4-hydrazinylidenebutanoic acid;4-(4-methylphenyl)-1H-pyrazole is sourced from PubChem (CID 144957614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).