About [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate
[4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate (PubChem CID 14495786) has the molecular formula C36H46F2O4
and a molecular weight of 580.76 g/mol. Its IUPAC name is [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate.
Molecular Properties
| Compound Name | [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate |
| PubChem CID | 14495786 |
| Molecular Formula | C36H46F2O4 |
| Molecular Weight | 580.76 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate |
| SMILES | CCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCCCCC)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C36H46F2O4/c1-3-5-7-9-11-13-14-26-40-30-20-18-29(19-21-30)36(39)42-31-22-16-28(17-23-31)32-24-25-33(35(38)34(32)37)41-27-15-12-10-8-6-4-2/h16-25H,3-15,26-27H2,1-2H3 |
| InChIKey | VWPRELFHPDUESC-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 580.76 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate?
The IUPAC name of [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate (CID 14495786) is [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate.
What is the SMILES notation for [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate?
The canonical SMILES for [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate is CCCCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(OCCCCCCCC)c(F)c3F)cc2)cc1.
What is the InChIKey of [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate?
The InChIKey is VWPRELFHPDUESC-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H46F2O4/c1-3-5-7-9-11-13-14-26-40-30-20-18-29(19-21-30)36(39)42-31-22-16-28(17-23-31)32-24-25-33(35(38)34(32)37)41-27-15-12-10-8-6-4-2/h16-25H,3-15,26-27H2,1-2H3.
What are the key properties of [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate?
[4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate has a molecular weight of 580.76 g/mol, XLogP of 10.72, 20 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,3-difluoro-4-octoxyphenyl)phenyl] 4-nonoxybenzoate is sourced from PubChem (CID 14495786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).