About (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide
(2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide (PubChem CID 144958449) has the molecular formula C17H32N2O2
and a molecular weight of 296.46 g/mol. Its IUPAC name is (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide.
Molecular Properties
| Compound Name | (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide |
| PubChem CID | 144958449 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide |
| SMILES | C=C/C=C1/NCCO/C1=C/C=C.CC.CC.CNC(C)=O |
| InChI | InChI=1S/C10H13NO.C3H7NO.2C2H6/c1-3-5-9-10(6-4-2)12-8-7-11-9;1-3(5)4-2;2*1-2/h3-6,11H,1-2,7-8H2;1-2H3,(H,4,5);2*1-2H3/b9-5+,10-6+;;; |
| InChIKey | XPJAFGSRMPVLRF-WDSFPQLTSA-N |
| XLogP | 3.55 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide?
The IUPAC name of (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide (CID 144958449) is (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide.
What is the SMILES notation for (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide?
The canonical SMILES for (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide is C=C/C=C1/NCCO/C1=C/C=C.CC.CC.CNC(C)=O.
What is the InChIKey of (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide?
The InChIKey is XPJAFGSRMPVLRF-WDSFPQLTSA-N. The full InChI is InChI=1S/C10H13NO.C3H7NO.2C2H6/c1-3-5-9-10(6-4-2)12-8-7-11-9;1-3(5)4-2;2*1-2/h3-6,11H,1-2,7-8H2;1-2H3,(H,4,5);2*1-2H3/b9-5+,10-6+;;;.
What are the key properties of (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide?
(2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide has a molecular weight of 296.46 g/mol, XLogP of 3.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2,3-bis(prop-2-enylidene)morpholine;ethane;N-methylacetamide is sourced from PubChem (CID 144958449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).