About 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile
3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile (PubChem CID 144958472) has the molecular formula C11H11BrN2O
and a molecular weight of 267.13 g/mol. Its IUPAC name is 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile |
| PubChem CID | 144958472 |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.13 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile |
| SMILES | N#CCC[C@H]1CNc2cc(Br)ccc2O1 |
| InChI | InChI=1S/C11H11BrN2O/c12-8-3-4-11-10(6-8)14-7-9(15-11)2-1-5-13/h3-4,6,9,14H,1-2,7H2/t9-/m0/s1 |
| InChIKey | FKROEINWDCCDIJ-VIFPVBQESA-N |
| XLogP | 2.93 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile?
The IUPAC name of 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile (CID 144958472) is 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile.
What is the SMILES notation for 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile?
The canonical SMILES for 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile is N#CCC[C@H]1CNc2cc(Br)ccc2O1.
What is the InChIKey of 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile?
The InChIKey is FKROEINWDCCDIJ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H11BrN2O/c12-8-3-4-11-10(6-8)14-7-9(15-11)2-1-5-13/h3-4,6,9,14H,1-2,7H2/t9-/m0/s1.
What are the key properties of 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile?
3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile has a molecular weight of 267.13 g/mol, XLogP of 2.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-6-bromo-3,4-dihydro-2H-1,4-benzoxazin-2-yl]propanenitrile is sourced from PubChem (CID 144958472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).