C29H26ClF6NO4S — CID 144958480
6-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine;2-methoxybut-1-ene (PubChem CID 144958480) has the molecular formula C29H26ClF6NO4S and a molecular weight of 634.04 g/mol. Its IUPAC name is 6-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine;2-methoxybut-1-ene.
| Compound Name | 6-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine;2-methoxybut-1-ene |
|---|---|
| PubChem CID | 144958480 |
| Molecular Formula | C29H26ClF6NO4S |
| Molecular Weight | 634.04 g/mol |
| Exact Mass | 633.12 |
| IUPAC Name | 6-[(E)-2-[2-chloro-6-(trifluoromethyl)phenyl]ethenyl]-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine;2-methoxybut-1-ene |
| SMILES | C=C(CC)OC.O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCOc2ccc(/C=C/c3c(Cl)cccc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C24H16ClF6NO3S.C5H10O/c25-20-6-2-5-19(24(29,30)31)18(20)9-7-15-8-10-22-21(13-15)32(11-12-35-22)36(33,34)17-4-1-3-16(14-17)23(26,27)28;1-4-5(2)6-3/h1-10,13-14H,11-12H2;2,4H2,1,3H3/b9-7+; |
| InChIKey | INCBBEQIEVOAIH-BXTVWIJMSA-N |
| XLogP | 8.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.04 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|