C27H38N2 — CID 144958721
9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene;2,3-dimethylbutane;ethane (PubChem CID 144958721) has the molecular formula C27H38N2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene;2,3-dimethylbutane;ethane.
| Compound Name | 9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene;2,3-dimethylbutane;ethane |
|---|---|
| PubChem CID | 144958721 |
| Molecular Formula | C27H38N2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 9,19-diazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-1(17),2,4,6,8,10,14(18),15-octaene;2,3-dimethylbutane;ethane |
| SMILES | CC.CC.CC(C)C(C)C.c1ccc2c(c1)c1cccc3c1n1c(cnc21)CC3 |
| InChI | InChI=1S/C17H12N2.C6H14.2C2H6/c1-2-6-15-13(5-1)14-7-3-4-11-8-9-12-10-18-17(15)19(12)16(11)14;1-5(2)6(3)4;2*1-2/h1-7,10H,8-9H2;5-6H,1-4H3;2*1-2H3 |
| InChIKey | XUNJLAFNRKKQFM-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|