About ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane
ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane (PubChem CID 144959274) has the molecular formula C19H39NO2
and a molecular weight of 313.53 g/mol. Its IUPAC name is ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane.
Molecular Properties
| Compound Name | ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane |
| PubChem CID | 144959274 |
| Molecular Formula | C19H39NO2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.30 |
| IUPAC Name | ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane |
| SMILES | CC.CCCC(C)C.COC(=O)N1CC2(CCC(C)CC2)C1 |
| InChI | InChI=1S/C11H19NO2.C6H14.C2H6/c1-9-3-5-11(6-4-9)7-12(8-11)10(13)14-2;1-4-5-6(2)3;1-2/h9H,3-8H2,1-2H3;6H,4-5H2,1-3H3;1-2H3 |
| InChIKey | BUDDQRKLAWCIHT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane?
The IUPAC name of ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane (CID 144959274) is ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane.
What is the SMILES notation for ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane?
The canonical SMILES for ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane is CC.CCCC(C)C.COC(=O)N1CC2(CCC(C)CC2)C1.
What is the InChIKey of ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane?
The InChIKey is BUDDQRKLAWCIHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2.C6H14.C2H6/c1-9-3-5-11(6-4-9)7-12(8-11)10(13)14-2;1-4-5-6(2)3;1-2/h9H,3-8H2,1-2H3;6H,4-5H2,1-3H3;1-2H3.
What are the key properties of ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane?
ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane has a molecular weight of 313.53 g/mol, XLogP of 5.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 7-methyl-2-azaspiro[3.5]nonane-2-carboxylate;2-methylpentane is sourced from PubChem (CID 144959274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).