About methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane
methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane (PubChem CID 144959303) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane.
Molecular Properties
| Compound Name | methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane |
| PubChem CID | 144959303 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane |
| SMILES | CC1CCC2(C1)CN(CC#N)C2.CCC.COC |
| InChI | InChI=1S/C10H16N2.C3H8.C2H6O/c1-9-2-3-10(6-9)7-12(8-10)5-4-11;2*1-3-2/h9H,2-3,5-8H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | IMKGBHOGKZLFHE-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane?
The IUPAC name of methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane (CID 144959303) is methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane.
What is the SMILES notation for methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane?
The canonical SMILES for methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane is CC1CCC2(C1)CN(CC#N)C2.CCC.COC.
What is the InChIKey of methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane?
The InChIKey is IMKGBHOGKZLFHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.C3H8.C2H6O/c1-9-2-3-10(6-9)7-12(8-10)5-4-11;2*1-3-2/h9H,2-3,5-8H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane?
methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane has a molecular weight of 254.42 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;2-(6-methyl-2-azaspiro[3.4]octan-2-yl)acetonitrile;propane is sourced from PubChem (CID 144959303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).