C22H30ClN6O4+ — CID 144959402
(E)-[amino-[[10-chloro-9-(3-methoxypropoxy)-2-oxo-6-propan-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carbonyl]amino]methylidene]-hydrazinylazanium (PubChem CID 144959402) has the molecular formula C22H30ClN6O4+ and a molecular weight of 477.97 g/mol. Its IUPAC name is (E)-[amino-[[10-chloro-9-(3-methoxypropoxy)-2-oxo-6-propan-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carbonyl]amino]methylidene]-hydrazinylazanium.
| Compound Name | (E)-[amino-[[10-chloro-9-(3-methoxypropoxy)-2-oxo-6-propan-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carbonyl]amino]methylidene]-hydrazinylazanium |
|---|---|
| PubChem CID | 144959402 |
| Molecular Formula | C22H30ClN6O4+ |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | (E)-[amino-[[10-chloro-9-(3-methoxypropoxy)-2-oxo-6-propan-2-yl-6,7-dihydrobenzo[a]quinolizine-3-carbonyl]amino]methylidene]-hydrazinylazanium |
| SMILES | COCCCOc1cc2c(cc1Cl)-c1cc(=O)c(C(=O)N/C(N)=[NH+]/NN)cn1C(C(C)C)C2 |
| InChI | InChI=1S/C22H29ClN6O4/c1-12(2)17-7-13-8-20(33-6-4-5-32-3)16(23)9-14(13)18-10-19(30)15(11-29(17)18)21(31)26-22(24)27-28-25/h8-12,17,28H,4-7,25H2,1-3H3,(H3,24,26,27,31)/p+1 |
| InChIKey | FSECKITZUXNWFS-UHFFFAOYSA-O |
| XLogP | -0.16 |
| TPSA | 147.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|