About 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one
3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one (PubChem CID 144959764) has the molecular formula C24H29O3S+
and a molecular weight of 397.56 g/mol. Its IUPAC name is 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one.
Molecular Properties
| Compound Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one |
| PubChem CID | 144959764 |
| Molecular Formula | C24H29O3S+ |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one |
| SMILES | CCC(C)(C)C(C(=O)c1ccc2c(c1)Cc1ccccc1O2)[S+]1CCOCC1 |
| InChI | InChI=1S/C24H29O3S/c1-4-24(2,3)23(28-13-11-26-12-14-28)22(25)18-9-10-21-19(16-18)15-17-7-5-6-8-20(17)27-21/h5-10,16,23H,4,11-15H2,1-3H3/q+1 |
| InChIKey | KBECKQXRKQRJPQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one?
The IUPAC name of 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one (CID 144959764) is 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one.
What is the SMILES notation for 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one?
The canonical SMILES for 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one is CCC(C)(C)C(C(=O)c1ccc2c(c1)Cc1ccccc1O2)[S+]1CCOCC1.
What is the InChIKey of 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one?
The InChIKey is KBECKQXRKQRJPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29O3S/c1-4-24(2,3)23(28-13-11-26-12-14-28)22(25)18-9-10-21-19(16-18)15-17-7-5-6-8-20(17)27-21/h5-10,16,23H,4,11-15H2,1-3H3/q+1.
What are the key properties of 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one?
3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one has a molecular weight of 397.56 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-(1,4-oxathian-4-ium-4-yl)-1-(9H-xanthen-2-yl)pentan-1-one is sourced from PubChem (CID 144959764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).