About (E)-2,3-difluorobut-2-en-1-ol
(E)-2,3-difluorobut-2-en-1-ol (PubChem CID 14496002) has the molecular formula C4H6F2O
and a molecular weight of 108.09 g/mol. Its IUPAC name is (E)-2,3-difluorobut-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-2,3-difluorobut-2-en-1-ol |
| PubChem CID | 14496002 |
| Molecular Formula | C4H6F2O |
| Molecular Weight | 108.09 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | (E)-2,3-difluorobut-2-en-1-ol |
| SMILES | C/C(F)=C(\F)CO |
| InChI | InChI=1S/C4H6F2O/c1-3(5)4(6)2-7/h7H,2H2,1H3/b4-3+ |
| InChIKey | XYWOWNUXAMPLGN-ONEGZZNKSA-N |
| XLogP | 1.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.09 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-2,3-difluorobut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-difluorobut-2-en-1-ol?
The IUPAC name of (E)-2,3-difluorobut-2-en-1-ol (CID 14496002) is (E)-2,3-difluorobut-2-en-1-ol.
What is the SMILES notation for (E)-2,3-difluorobut-2-en-1-ol?
The canonical SMILES for (E)-2,3-difluorobut-2-en-1-ol is C/C(F)=C(\F)CO.
What is the InChIKey of (E)-2,3-difluorobut-2-en-1-ol?
The InChIKey is XYWOWNUXAMPLGN-ONEGZZNKSA-N. The full InChI is InChI=1S/C4H6F2O/c1-3(5)4(6)2-7/h7H,2H2,1H3/b4-3+.
What are the key properties of (E)-2,3-difluorobut-2-en-1-ol?
(E)-2,3-difluorobut-2-en-1-ol has a molecular weight of 108.09 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-difluorobut-2-en-1-ol is sourced from PubChem (CID 14496002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).