About 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene
1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene (PubChem CID 144960746) has the molecular formula C22H31Cl3S
and a molecular weight of 433.92 g/mol. Its IUPAC name is 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene |
| PubChem CID | 144960746 |
| Molecular Formula | C22H31Cl3S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene |
| SMILES | CC.CCCc1cccs1.Clc1cc(Cl)cc(CCC2CCC(Cl)C2)c1 |
| InChI | InChI=1S/C13H15Cl3.C7H10S.C2H6/c14-11-4-3-9(5-11)1-2-10-6-12(15)8-13(16)7-10;1-2-4-7-5-3-6-8-7;1-2/h6-9,11H,1-5H2;3,5-6H,2,4H2,1H3;1-2H3 |
| InChIKey | PWBQORNRJRWEOO-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene?
The IUPAC name of 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene (CID 144960746) is 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene.
What is the SMILES notation for 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene?
The canonical SMILES for 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene is CC.CCCc1cccs1.Clc1cc(Cl)cc(CCC2CCC(Cl)C2)c1.
What is the InChIKey of 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene?
The InChIKey is PWBQORNRJRWEOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl3.C7H10S.C2H6/c14-11-4-3-9(5-11)1-2-10-6-12(15)8-13(16)7-10;1-2-4-7-5-3-6-8-7;1-2/h6-9,11H,1-5H2;3,5-6H,2,4H2,1H3;1-2H3.
What are the key properties of 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene?
1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene has a molecular weight of 433.92 g/mol, XLogP of 9.06, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-[2-(3-chlorocyclopentyl)ethyl]benzene;ethane;2-propylthiophene is sourced from PubChem (CID 144960746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).