About N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane
N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane (PubChem CID 144961951) has the molecular formula C17H32N2
and a molecular weight of 264.46 g/mol. Its IUPAC name is N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane.
Molecular Properties
| Compound Name | N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane |
| PubChem CID | 144961951 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane |
| SMILES | C=C(C)/C(C)=C(\N=C(C)C)NC1CCCCC1.CC |
| InChI | InChI=1S/C15H26N2.C2H6/c1-11(2)13(5)15(16-12(3)4)17-14-9-7-6-8-10-14;1-2/h14,17H,1,6-10H2,2-5H3;1-2H3/b15-13+; |
| InChIKey | FZIAWKMVMGUOHS-GVYCEHEKSA-N |
| XLogP | 5.22 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane?
The IUPAC name of N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane (CID 144961951) is N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane.
What is the SMILES notation for N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane?
The canonical SMILES for N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane is C=C(C)/C(C)=C(\N=C(C)C)NC1CCCCC1.CC.
What is the InChIKey of N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane?
The InChIKey is FZIAWKMVMGUOHS-GVYCEHEKSA-N. The full InChI is InChI=1S/C15H26N2.C2H6/c1-11(2)13(5)15(16-12(3)4)17-14-9-7-6-8-10-14;1-2/h14,17H,1,6-10H2,2-5H3;1-2H3/b15-13+;.
What are the key properties of N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane?
N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane has a molecular weight of 264.46 g/mol, XLogP of 5.22, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-2,3-dimethyl-1-(propan-2-ylideneamino)buta-1,3-dienyl]cyclohexanamine;ethane is sourced from PubChem (CID 144961951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).