C28H30N6O3 — CID 144962002
N-[N'-(ethyliminomethyl)carbamimidoyl]-2-[hydroxy(diphenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxamide (PubChem CID 144962002) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[N'-(ethyliminomethyl)carbamimidoyl]-2-[hydroxy(diphenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxamide.
| Compound Name | N-[N'-(ethyliminomethyl)carbamimidoyl]-2-[hydroxy(diphenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 144962002 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | N-[N'-(ethyliminomethyl)carbamimidoyl]-2-[hydroxy(diphenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxamide |
| SMILES | CC/N=C/N=C(\N)NC(=O)c1ccc2nc(C(O)(c3ccccc3)c3ccccc3)n(CCOC)c2c1 |
| InChI | InChI=1S/C28H30N6O3/c1-3-30-19-31-27(29)33-25(35)20-14-15-23-24(18-20)34(16-17-37-2)26(32-23)28(36,21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-15,18-19,36H,3,16-17H2,1-2H3,(H3,29,30,31,33,35) |
| InChIKey | MVRAFVJHJQBNMT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|