About (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one
(3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one (PubChem CID 144962091) has the molecular formula C19H22O2
and a molecular weight of 282.38 g/mol. Its IUPAC name is (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one |
| PubChem CID | 144962091 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one |
| SMILES | C=Cc1ccc(CC(O)/C=C/[C@H]2CCC(=O)C2)cc1C=C |
| InChI | InChI=1S/C19H22O2/c1-3-16-8-5-15(11-17(16)4-2)13-19(21)10-7-14-6-9-18(20)12-14/h3-5,7-8,10-11,14,19,21H,1-2,6,9,12-13H2/b10-7+/t14-,19?/m1/s1 |
| InChIKey | KISABWVIHIWYDU-NMRQZHRASA-N |
| XLogP | 3.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one?
The IUPAC name of (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one (CID 144962091) is (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one.
What is the SMILES notation for (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one?
The canonical SMILES for (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one is C=Cc1ccc(CC(O)/C=C/[C@H]2CCC(=O)C2)cc1C=C.
What is the InChIKey of (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one?
The InChIKey is KISABWVIHIWYDU-NMRQZHRASA-N. The full InChI is InChI=1S/C19H22O2/c1-3-16-8-5-15(11-17(16)4-2)13-19(21)10-7-14-6-9-18(20)12-14/h3-5,7-8,10-11,14,19,21H,1-2,6,9,12-13H2/b10-7+/t14-,19?/m1/s1.
What are the key properties of (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one?
(3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one has a molecular weight of 282.38 g/mol, XLogP of 3.80, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[(E)-4-[3,4-bis(ethenyl)phenyl]-3-hydroxybut-1-enyl]cyclopentan-1-one is sourced from PubChem (CID 144962091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).