About 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one
4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one (PubChem CID 144962121) has the molecular formula C29H32O5
and a molecular weight of 460.57 g/mol. Its IUPAC name is 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one |
| PubChem CID | 144962121 |
| Molecular Formula | C29H32O5 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one |
| SMILES | CCc1ccc(C(=O)O)cc1.COc1ccc2cc(CC(O)/C=C/C3CCC(=O)C3)ccc2c1 |
| InChI | InChI=1S/C20H22O3.C9H10O2/c1-23-20-9-6-16-10-15(2-5-17(16)13-20)12-19(22)8-4-14-3-7-18(21)11-14;1-2-7-3-5-8(6-4-7)9(10)11/h2,4-6,8-10,13-14,19,22H,3,7,11-12H2,1H3;3-6H,2H2,1H3,(H,10,11)/b8-4+; |
| InChIKey | WJCYFVILFCNNNV-ZFXMFRGYSA-N |
| XLogP | 5.62 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one?
The IUPAC name of 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one (CID 144962121) is 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one.
What is the SMILES notation for 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one?
The canonical SMILES for 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one is CCc1ccc(C(=O)O)cc1.COc1ccc2cc(CC(O)/C=C/C3CCC(=O)C3)ccc2c1.
What is the InChIKey of 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one?
The InChIKey is WJCYFVILFCNNNV-ZFXMFRGYSA-N. The full InChI is InChI=1S/C20H22O3.C9H10O2/c1-23-20-9-6-16-10-15(2-5-17(16)13-20)12-19(22)8-4-14-3-7-18(21)11-14;1-2-7-3-5-8(6-4-7)9(10)11/h2,4-6,8-10,13-14,19,22H,3,7,11-12H2,1H3;3-6H,2H2,1H3,(H,10,11)/b8-4+;.
What are the key properties of 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one?
4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one has a molecular weight of 460.57 g/mol, XLogP of 5.62, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzoic acid;3-[(E)-3-hydroxy-4-(6-methoxynaphthalen-2-yl)but-1-enyl]cyclopentan-1-one is sourced from PubChem (CID 144962121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).