C26H39N3O5S — CID 144962240
(9-methyl-2,8-dioxabicyclo[4.2.1]nonan-5-yl) N-[3-[[4-(1-carbamoylcyclopropyl)phenyl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate (PubChem CID 144962240) has the molecular formula C26H39N3O5S and a molecular weight of 505.68 g/mol. Its IUPAC name is (9-methyl-2,8-dioxabicyclo[4.2.1]nonan-5-yl) N-[3-[[4-(1-carbamoylcyclopropyl)phenyl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate.
| Compound Name | (9-methyl-2,8-dioxabicyclo[4.2.1]nonan-5-yl) N-[3-[[4-(1-carbamoylcyclopropyl)phenyl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 144962240 |
| Molecular Formula | C26H39N3O5S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (9-methyl-2,8-dioxabicyclo[4.2.1]nonan-5-yl) N-[3-[[4-(1-carbamoylcyclopropyl)phenyl]sulfanyl-(2-methylpropyl)amino]propyl]carbamate |
| SMILES | CC(C)CN(CCCNC(=O)OC1CCOC2OCC1C2C)Sc1ccc(C2(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C26H39N3O5S/c1-17(2)15-29(35-20-7-5-19(6-8-20)26(10-11-26)24(27)30)13-4-12-28-25(31)34-22-9-14-32-23-18(3)21(22)16-33-23/h5-8,17-18,21-23H,4,9-16H2,1-3H3,(H2,27,30)(H,28,31) |
| InChIKey | MMULLLQYTLQJIZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|