C27H28N2O3 — CID 144962497
formic acid;8-[(1-phenyl-2,3,4,5-tetrahydro-1-benzazepin-8-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene (PubChem CID 144962497) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is formic acid;8-[(1-phenyl-2,3,4,5-tetrahydro-1-benzazepin-8-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene.
| Compound Name | formic acid;8-[(1-phenyl-2,3,4,5-tetrahydro-1-benzazepin-8-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene |
|---|---|
| PubChem CID | 144962497 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | formic acid;8-[(1-phenyl-2,3,4,5-tetrahydro-1-benzazepin-8-yl)methoxy]-9-azatricyclo[4.4.0.02,4]deca-1(10),6,8-triene |
| SMILES | O=CO.c1ccc(N2CCCCc3ccc(COc4cc5c(cn4)C4CC4C5)cc32)cc1 |
| InChI | InChI=1S/C26H26N2O.CH2O2/c1-2-7-22(8-3-1)28-11-5-4-6-19-10-9-18(12-25(19)28)17-29-26-15-21-13-20-14-23(20)24(21)16-27-26;2-1-3/h1-3,7-10,12,15-16,20,23H,4-6,11,13-14,17H2;1H,(H,2,3) |
| InChIKey | VZBQQYPTJQYEBY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|