C18H34O2 — CID 144962550
(3aS,4aR,7R,8aR)-2,2,3a,4,4,7-hexamethyl-5,6,7,7a,8,8a-hexahydro-4aH-indeno[5,6-d][1,3]dioxole;ethane (PubChem CID 144962550) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is (3aS,4aR,7R,8aR)-2,2,3a,4,4,7-hexamethyl-5,6,7,7a,8,8a-hexahydro-4aH-indeno[5,6-d][1,3]dioxole;ethane.
| Compound Name | (3aS,4aR,7R,8aR)-2,2,3a,4,4,7-hexamethyl-5,6,7,7a,8,8a-hexahydro-4aH-indeno[5,6-d][1,3]dioxole;ethane |
|---|---|
| PubChem CID | 144962550 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | (3aS,4aR,7R,8aR)-2,2,3a,4,4,7-hexamethyl-5,6,7,7a,8,8a-hexahydro-4aH-indeno[5,6-d][1,3]dioxole;ethane |
| SMILES | CC.C[C@@H]1CC[C@@H]2C1C[C@H]1OC(C)(C)O[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C16H28O2.C2H6/c1-10-7-8-12-11(10)9-13-16(6,14(12,2)3)18-15(4,5)17-13;1-2/h10-13H,7-9H2,1-6H3;1-2H3/t10-,11?,12-,13-,16-;/m1./s1 |
| InChIKey | LDVGEUDHMYFLMQ-BBCBBOMYSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |