C17H28N2O2 — CID 144962641
benzamide;1,2,2,6,6-pentamethylpiperidin-4-ol (PubChem CID 144962641) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is benzamide;1,2,2,6,6-pentamethylpiperidin-4-ol.
| Compound Name | benzamide;1,2,2,6,6-pentamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 144962641 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | benzamide;1,2,2,6,6-pentamethylpiperidin-4-ol |
| SMILES | CN1C(C)(C)CC(O)CC1(C)C.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H21NO.C7H7NO/c1-9(2)6-8(12)7-10(3,4)11(9)5;8-7(9)6-4-2-1-3-5-6/h8,12H,6-7H2,1-5H3;1-5H,(H2,8,9) |
| InChIKey | INTQNBPPKPAXRB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |