About ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine
ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine (PubChem CID 144962776) has the molecular formula C17H31FN2
and a molecular weight of 282.45 g/mol. Its IUPAC name is ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine.
Molecular Properties
| Compound Name | ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine |
| PubChem CID | 144962776 |
| Molecular Formula | C17H31FN2 |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.25 |
| IUPAC Name | ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine |
| SMILES | CC.CF.CN1CCC(NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C14H22N2.C2H6.CH3F/c1-16-11-8-14(9-12-16)15-10-7-13-5-3-2-4-6-13;2*1-2/h2-6,14-15H,7-12H2,1H3;1-2H3;1H3 |
| InChIKey | LRVAANLIIRGACC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine?
The IUPAC name of ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine (CID 144962776) is ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine.
What is the SMILES notation for ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine?
The canonical SMILES for ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine is CC.CF.CN1CCC(NCCc2ccccc2)CC1.
What is the InChIKey of ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine?
The InChIKey is LRVAANLIIRGACC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2.C2H6.CH3F/c1-16-11-8-14(9-12-16)15-10-7-13-5-3-2-4-6-13;2*1-2/h2-6,14-15H,7-12H2,1H3;1-2H3;1H3.
What are the key properties of ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine?
ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine has a molecular weight of 282.45 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;fluoromethane;1-methyl-N-(2-phenylethyl)piperidin-4-amine is sourced from PubChem (CID 144962776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).