C17H33N3 — CID 144962793
ethane;2-ethyl-2-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]pentanenitrile (PubChem CID 144962793) has the molecular formula C17H33N3 and a molecular weight of 279.47 g/mol. Its IUPAC name is ethane;2-ethyl-2-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]pentanenitrile.
| Compound Name | ethane;2-ethyl-2-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]pentanenitrile |
|---|---|
| PubChem CID | 144962793 |
| Molecular Formula | C17H33N3 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.27 |
| IUPAC Name | ethane;2-ethyl-2-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]pentanenitrile |
| SMILES | CC.CCCC(C#N)(CC)CN1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C15H27N3.C2H6/c1-4-6-15(5-2,11-16)12-18-9-13-7-17(3)8-14(13)10-18;1-2/h13-14H,4-10,12H2,1-3H3;1-2H3 |
| InChIKey | NULMYOGVZFTRSJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |