C14H21F3N2 — CID 144962808
N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-1-methylpiperidin-4-amine (PubChem CID 144962808) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-1-methylpiperidin-4-amine.
| Compound Name | N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 144962808 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-1-methylpiperidin-4-amine |
| SMILES | C=C/C=C(\C=C)C(NC1CCN(C)CC1)C(F)(F)F |
| InChI | InChI=1S/C14H21F3N2/c1-4-6-11(5-2)13(14(15,16)17)18-12-7-9-19(3)10-8-12/h4-6,12-13,18H,1-2,7-10H2,3H3/b11-6+ |
| InChIKey | MCONOAGNOSKGOL-IZZDOVSWSA-N |
| XLogP | 2.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|