C12H28N2O2S — CID 144962938
(3aR)-5-(3-methylsulfonylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;molecular hydrogen (PubChem CID 144962938) has the molecular formula C12H28N2O2S and a molecular weight of 264.43 g/mol. Its IUPAC name is (3aR)-5-(3-methylsulfonylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;molecular hydrogen.
| Compound Name | (3aR)-5-(3-methylsulfonylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 144962938 |
| Molecular Formula | C12H28N2O2S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | (3aR)-5-(3-methylsulfonylpropyl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole;ethane;molecular hydrogen |
| SMILES | CC.CS(=O)(=O)CCCN1CC2CNC[C@@H]2C1.[H][H] |
| InChI | InChI=1S/C10H20N2O2S.C2H6.H2/c1-15(13,14)4-2-3-12-7-9-5-11-6-10(9)8-12;1-2;/h9-11H,2-8H2,1H3;1-2H3;1H/t9-,10?;;/m1../s1 |
| InChIKey | WNHZLJVMZYHERN-BFBVBPSISA-N |
| XLogP | 0.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |