C25H22ClF2N5O2S — CID 144962990
(2Z)-N-[4-[5-chloro-2-(difluoromethoxy)phenyl]-2-pyridin-4-yl-1,3-thiazol-5-yl]-2-[dimethylamino-[(Z)-prop-2-enylideneamino]methylidene]but-3-enamide (PubChem CID 144962990) has the molecular formula C25H22ClF2N5O2S and a molecular weight of 530.00 g/mol. Its IUPAC name is (2Z)-N-[4-[5-chloro-2-(difluoromethoxy)phenyl]-2-pyridin-4-yl-1,3-thiazol-5-yl]-2-[dimethylamino-[(Z)-prop-2-enylideneamino]methylidene]but-3-enamide.
| Compound Name | (2Z)-N-[4-[5-chloro-2-(difluoromethoxy)phenyl]-2-pyridin-4-yl-1,3-thiazol-5-yl]-2-[dimethylamino-[(Z)-prop-2-enylideneamino]methylidene]but-3-enamide |
|---|---|
| PubChem CID | 144962990 |
| Molecular Formula | C25H22ClF2N5O2S |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (2Z)-N-[4-[5-chloro-2-(difluoromethoxy)phenyl]-2-pyridin-4-yl-1,3-thiazol-5-yl]-2-[dimethylamino-[(Z)-prop-2-enylideneamino]methylidene]but-3-enamide |
| SMILES | C=C/C=N\C(=C(\C=C)C(=O)Nc1sc(-c2ccncc2)nc1-c1cc(Cl)ccc1OC(F)F)N(C)C |
| InChI | InChI=1S/C25H22ClF2N5O2S/c1-5-11-30-21(33(3)4)17(6-2)22(34)32-24-20(31-23(36-24)15-9-12-29-13-10-15)18-14-16(26)7-8-19(18)35-25(27)28/h5-14,25H,1-2H2,3-4H3,(H,32,34)/b21-17+,30-11- |
| InChIKey | CQQVEJXGEMOFNV-SBGFLIPFSA-N |
| XLogP | 6.28 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|