C23H32FNO6 — CID 144963265
fluoro 2-[(Z)-1-(2,3-dihydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino]oxyacetate (PubChem CID 144963265) has the molecular formula C23H32FNO6 and a molecular weight of 437.51 g/mol. Its IUPAC name is fluoro 2-[(Z)-1-(2,3-dihydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino]oxyacetate.
| Compound Name | fluoro 2-[(Z)-1-(2,3-dihydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino]oxyacetate |
|---|---|
| PubChem CID | 144963265 |
| Molecular Formula | C23H32FNO6 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | fluoro 2-[(Z)-1-(2,3-dihydroxy-10,13-dimethyl-6-oxo-1,2,3,4,5,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethylideneamino]oxyacetate |
| SMILES | C/C(=N/OCC(=O)OF)C1CCC2C3=CC(=O)C4CC(O)C(O)CC4(C)C3CCC21C |
| InChI | InChI=1S/C23H32FNO6/c1-12(25-30-11-21(29)31-24)14-4-5-15-13-8-18(26)17-9-19(27)20(28)10-23(17,3)16(13)6-7-22(14,15)2/h8,14-17,19-20,27-28H,4-7,9-11H2,1-3H3/b25-12- |
| InChIKey | JFEXEDLRLJGEMD-ROTLSHHCSA-N |
| XLogP | 2.90 |
| TPSA | 105.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|