C23H28N2O3 — CID 144963627
methyl (E)-3-[2-[(4-hexan-3-ylphenyl)carbamoylamino]phenyl]prop-2-enoate (PubChem CID 144963627) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is methyl (E)-3-[2-[(4-hexan-3-ylphenyl)carbamoylamino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-[(4-hexan-3-ylphenyl)carbamoylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 144963627 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | methyl (E)-3-[2-[(4-hexan-3-ylphenyl)carbamoylamino]phenyl]prop-2-enoate |
| SMILES | CCCC(CC)c1ccc(NC(=O)Nc2ccccc2/C=C/C(=O)OC)cc1 |
| InChI | InChI=1S/C23H28N2O3/c1-4-8-17(5-2)18-11-14-20(15-12-18)24-23(27)25-21-10-7-6-9-19(21)13-16-22(26)28-3/h6-7,9-17H,4-5,8H2,1-3H3,(H2,24,25,27)/b16-13+ |
| InChIKey | BWMDYKHUHOQYRH-DTQAZKPQSA-N |
| XLogP | 5.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|