C39H29N4- — CID 144963882
9-(4,6-diphenyl-1,3-diaza-5-azanidacyclohex-2-en-2-yl)-2,6-diphenylcarbazole (PubChem CID 144963882) has the molecular formula C39H29N4- and a molecular weight of 553.69 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3-diaza-5-azanidacyclohex-2-en-2-yl)-2,6-diphenylcarbazole.
| Compound Name | 9-(4,6-diphenyl-1,3-diaza-5-azanidacyclohex-2-en-2-yl)-2,6-diphenylcarbazole |
|---|---|
| PubChem CID | 144963882 |
| Molecular Formula | C39H29N4- |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 9-(4,6-diphenyl-1,3-diaza-5-azanidacyclohex-2-en-2-yl)-2,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2ccc(-c4ccccc4)cc2n3C2=NC(c3ccccc3)[N-]C(c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C39H29N4/c1-5-13-27(14-6-1)31-22-24-35-34(25-31)33-23-21-32(28-15-7-2-8-16-28)26-36(33)43(35)39-41-37(29-17-9-3-10-18-29)40-38(42-39)30-19-11-4-12-20-30/h1-26,37-38H,(H,41,42)/q-1 |
| InChIKey | HATIIARGWHLUFB-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |