About (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane
(Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane (PubChem CID 144963893) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane.
Molecular Properties
| Compound Name | (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane |
| PubChem CID | 144963893 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane |
| SMILES | CC.[H]/N=C/C=C\CC1C=CCN1 |
| InChI | InChI=1S/C8H12N2.C2H6/c9-6-2-1-4-8-5-3-7-10-8;1-2/h1-3,5-6,8-10H,4,7H2;1-2H3/b2-1-,9-6+; |
| InChIKey | XLGHWWVGPYMZOK-SMYMJCLPSA-N |
| XLogP | 2.14 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane?
The IUPAC name of (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane (CID 144963893) is (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane.
What is the SMILES notation for (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane?
The canonical SMILES for (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane is CC.[H]/N=C/C=C\CC1C=CCN1.
What is the InChIKey of (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane?
The InChIKey is XLGHWWVGPYMZOK-SMYMJCLPSA-N. The full InChI is InChI=1S/C8H12N2.C2H6/c9-6-2-1-4-8-5-3-7-10-8;1-2/h1-3,5-6,8-10H,4,7H2;1-2H3/b2-1-,9-6+;.
What are the key properties of (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane?
(Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane has a molecular weight of 166.27 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(2,5-dihydro-1H-pyrrol-2-yl)but-2-en-1-imine;ethane is sourced from PubChem (CID 144963893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).