C28H39N5O3 — CID 144964189
tert-butyl 3-[[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate;ethane (PubChem CID 144964189) has the molecular formula C28H39N5O3 and a molecular weight of 493.65 g/mol. Its IUPAC name is tert-butyl 3-[[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 3-[[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144964189 |
| Molecular Formula | C28H39N5O3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.31 |
| IUPAC Name | tert-butyl 3-[[6-(3-phenoxyprop-1-ynyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CCC(Nc2ncnc3[nH]c(C#CCOc4ccccc4)cc23)C1 |
| InChI | InChI=1S/C24H27N5O3.2C2H6/c1-24(2,3)32-23(30)29-12-11-18(15-29)28-22-20-14-17(27-21(20)25-16-26-22)8-7-13-31-19-9-5-4-6-10-19;2*1-2/h4-6,9-10,14,16,18H,11-13,15H2,1-3H3,(H2,25,26,27,28);2*1-2H3 |
| InChIKey | LYOHVEKLCHIAFC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|