About molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine
molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine (PubChem CID 144964244) has the molecular formula C18H22N6O
and a molecular weight of 338.41 g/mol. Its IUPAC name is molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine.
Molecular Properties
| Compound Name | molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine |
| PubChem CID | 144964244 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine |
| SMILES | C(#Cc1nc2ncnc(N3CCNCC3)c2[nH]1)COc1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C18H18N6O.2H2/c1-2-5-14(6-3-1)25-12-4-7-15-22-16-17(23-15)20-13-21-18(16)24-10-8-19-9-11-24;;/h1-3,5-6,13,19H,8-12H2,(H,20,21,22,23);2*1H |
| InChIKey | BLSUDHPSEOJOMS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine?
The IUPAC name of molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine (CID 144964244) is molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine.
What is the SMILES notation for molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine?
The canonical SMILES for molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine is C(#Cc1nc2ncnc(N3CCNCC3)c2[nH]1)COc1ccccc1.[H][H].[H][H].
What is the InChIKey of molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine?
The InChIKey is BLSUDHPSEOJOMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N6O.2H2/c1-2-5-14(6-3-1)25-12-4-7-15-22-16-17(23-15)20-13-21-18(16)24-10-8-19-9-11-24;;/h1-3,5-6,13,19H,8-12H2,(H,20,21,22,23);2*1H.
What are the key properties of molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine?
molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine has a molecular weight of 338.41 g/mol, XLogP of 1.68, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;8-(3-phenoxyprop-1-ynyl)-6-piperazin-1-yl-7H-purine is sourced from PubChem (CID 144964244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).