About (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile
(4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile (PubChem CID 144964287) has the molecular formula C18H20N2O
and a molecular weight of 280.37 g/mol. Its IUPAC name is (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile.
Molecular Properties
| Compound Name | (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile |
| PubChem CID | 144964287 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile |
| SMILES | N#CN1CCCC1.OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O.C5H8N2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;6-5-7-3-1-2-4-7/h1-9,14H,10H2;1-4H2 |
| InChIKey | ICCQTFVFWQWWAW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile?
The IUPAC name of (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile (CID 144964287) is (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile.
What is the SMILES notation for (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile?
The canonical SMILES for (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile is N#CN1CCCC1.OCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile?
The InChIKey is ICCQTFVFWQWWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O.C5H8N2/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;6-5-7-3-1-2-4-7/h1-9,14H,10H2;1-4H2.
What are the key properties of (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile?
(4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile has a molecular weight of 280.37 g/mol, XLogP of 3.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl)methanol;pyrrolidine-1-carbonitrile is sourced from PubChem (CID 144964287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).