C29H44BFO7 — CID 144964415
tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate;1-methoxybutane (PubChem CID 144964415) has the molecular formula C29H44BFO7 and a molecular weight of 534.47 g/mol. Its IUPAC name is tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate;1-methoxybutane.
| Compound Name | tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate;1-methoxybutane |
|---|---|
| PubChem CID | 144964415 |
| Molecular Formula | C29H44BFO7 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate;1-methoxybutane |
| SMILES | CC(C)(C)OC(=O)Oc1c(CCB2OC3CC4CC(C4(C)C)C3(C)O2)ccc(F)c1C=O.CCCCOC |
| InChI | InChI=1S/C24H32BFO6.C5H12O/c1-22(2,3)30-21(28)29-20-14(7-8-17(26)16(20)13-27)9-10-25-31-19-12-15-11-18(23(15,4)5)24(19,6)32-25;1-3-4-5-6-2/h7-8,13,15,18-19H,9-12H2,1-6H3;3-5H2,1-2H3 |
| InChIKey | FLXKOKWYWICMFH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|