C24H32BFO6 — CID 144964416
tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate (PubChem CID 144964416) has the molecular formula C24H32BFO6 and a molecular weight of 446.32 g/mol. Its IUPAC name is tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate.
| Compound Name | tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate |
|---|---|
| PubChem CID | 144964416 |
| Molecular Formula | C24H32BFO6 |
| Molecular Weight | 446.32 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | tert-butyl [3-fluoro-2-formyl-6-[2-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)ethyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1c(CCB2OC3CC4CC(C4(C)C)C3(C)O2)ccc(F)c1C=O |
| InChI | InChI=1S/C24H32BFO6/c1-22(2,3)30-21(28)29-20-14(7-8-17(26)16(20)13-27)9-10-25-31-19-12-15-11-18(23(15,4)5)24(19,6)32-25/h7-8,13,15,18-19H,9-12H2,1-6H3 |
| InChIKey | SLLFVPOJCZOWOL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.32 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|