C17H32N2 — CID 144965155
1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine;ethane (PubChem CID 144965155) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine;ethane.
| Compound Name | 1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine;ethane |
|---|---|
| PubChem CID | 144965155 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine;ethane |
| SMILES | C=C/C(=C(\C=C/C)C(C)CC)N1CCNCC1.CC |
| InChI | InChI=1S/C15H26N2.C2H6/c1-5-8-14(13(4)6-2)15(7-3)17-11-9-16-10-12-17;1-2/h5,7-8,13,16H,3,6,9-12H2,1-2,4H3;1-2H3/b8-5-,15-14-; |
| InChIKey | RBKXKYFGCRTPPQ-ZBUSOPPMSA-N |
| XLogP | 3.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|