C15H26N2 — CID 144965156
1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine (PubChem CID 144965156) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine.
| Compound Name | 1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine |
|---|---|
| PubChem CID | 144965156 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-[(3E,5Z)-4-butan-2-ylhepta-1,3,5-trien-3-yl]piperazine |
| SMILES | C=C/C(=C(\C=C/C)C(C)CC)N1CCNCC1 |
| InChI | InChI=1S/C15H26N2/c1-5-8-14(13(4)6-2)15(7-3)17-11-9-16-10-12-17/h5,7-8,13,16H,3,6,9-12H2,1-2,4H3/b8-5-,15-14- |
| InChIKey | FTTTXTYOLNVACB-RFFGWJKESA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|