About 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride
2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride (PubChem CID 14496548) has the molecular formula C18H17ClO7
and a molecular weight of 380.78 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride.
Molecular Properties
| Compound Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride |
| PubChem CID | 14496548 |
| Molecular Formula | C18H17ClO7 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(OC)c3cc2O)cc(OC)c1O.[Cl-] |
| InChI | InChI=1S/C18H16O7.ClH/c1-22-13-6-10(19)7-14-11(13)8-12(20)18(25-14)9-4-15(23-2)17(21)16(5-9)24-3;/h4-8H,1-3H3,(H2-,19,20,21);1H |
| InChIKey | MLSUFFJQWFLOAR-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride?
The IUPAC name of 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride (CID 14496548) is 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride.
What is the SMILES notation for 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride?
The canonical SMILES for 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride is COc1cc(-c2[o+]c3cc(O)cc(OC)c3cc2O)cc(OC)c1O.[Cl-].
What is the InChIKey of 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride?
The InChIKey is MLSUFFJQWFLOAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O7.ClH/c1-22-13-6-10(19)7-14-11(13)8-12(20)18(25-14)9-4-15(23-2)17(21)16(5-9)24-3;/h4-8H,1-3H3,(H2-,19,20,21);1H.
What are the key properties of 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride?
2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride has a molecular weight of 380.78 g/mol, XLogP of 0.53, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-3,5-dimethoxyphenyl)-5-methoxychromenylium-3,7-diol chloride is sourced from PubChem (CID 14496548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).