C23H29F3N6O3S — CID 144966061
methyl 6-(butylsulfinamoylamino)-1-(1-methylimidazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate;1,2,3-trifluorobenzene (PubChem CID 144966061) has the molecular formula C23H29F3N6O3S and a molecular weight of 526.59 g/mol. Its IUPAC name is methyl 6-(butylsulfinamoylamino)-1-(1-methylimidazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate;1,2,3-trifluorobenzene.
| Compound Name | methyl 6-(butylsulfinamoylamino)-1-(1-methylimidazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate;1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 144966061 |
| Molecular Formula | C23H29F3N6O3S |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | methyl 6-(butylsulfinamoylamino)-1-(1-methylimidazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate;1,2,3-trifluorobenzene |
| SMILES | CCCCNS(=O)NC1CC2=C(C(=O)OC)CN=C(c3nccn3C)N2C1.Fc1cccc(F)c1F |
| InChI | InChI=1S/C17H26N6O3S.C6H3F3/c1-4-5-6-20-27(25)21-12-9-14-13(17(24)26-3)10-19-16(23(14)11-12)15-18-7-8-22(15)2;7-4-2-1-3-5(8)6(4)9/h7-8,12,20-21H,4-6,9-11H2,1-3H3;1-3H |
| InChIKey | ROULNHGAKICAOS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|