C21H23BrFN5O4S2 — CID 144966173
ethyl (3R)-3-(2-bromo-4-fluorophenyl)-6-[(methylsulfamoylamino)methyl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate (PubChem CID 144966173) has the molecular formula C21H23BrFN5O4S2 and a molecular weight of 572.48 g/mol. Its IUPAC name is ethyl (3R)-3-(2-bromo-4-fluorophenyl)-6-[(methylsulfamoylamino)methyl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate.
| Compound Name | ethyl (3R)-3-(2-bromo-4-fluorophenyl)-6-[(methylsulfamoylamino)methyl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 144966173 |
| Molecular Formula | C21H23BrFN5O4S2 |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 571.04 |
| IUPAC Name | ethyl (3R)-3-(2-bromo-4-fluorophenyl)-6-[(methylsulfamoylamino)methyl]-1-(1,3-thiazol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine-4-carboxylate |
| SMILES | CCOC(=O)C1=C2CC(CNS(=O)(=O)NC)CN2C(c2nccs2)=N[C@H]1c1ccc(F)cc1Br |
| InChI | InChI=1S/C21H23BrFN5O4S2/c1-3-32-21(29)17-16-8-12(10-26-34(30,31)24-2)11-28(16)19(20-25-6-7-33-20)27-18(17)14-5-4-13(23)9-15(14)22/h4-7,9,12,18,24,26H,3,8,10-11H2,1-2H3/t12?,18-/m0/s1 |
| InChIKey | VYZVDIKVQOOGEN-ZJFPTPTDSA-N |
| XLogP | 2.74 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |