C17H24N4OS — CID 144966242
4-[(Z)-1-methoxybut-1-enyl]-N-methylsulfanyl-1-(3H-pyrrol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine (PubChem CID 144966242) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 4-[(Z)-1-methoxybut-1-enyl]-N-methylsulfanyl-1-(3H-pyrrol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine.
| Compound Name | 4-[(Z)-1-methoxybut-1-enyl]-N-methylsulfanyl-1-(3H-pyrrol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
|---|---|
| PubChem CID | 144966242 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[(Z)-1-methoxybut-1-enyl]-N-methylsulfanyl-1-(3H-pyrrol-2-yl)-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-amine |
| SMILES | CC/C=C(\OC)C1=C2CC(NSC)CN2C(C2=NC=CC2)=NC1 |
| InChI | InChI=1S/C17H24N4OS/c1-4-6-16(22-2)13-10-19-17(14-7-5-8-18-14)21-11-12(20-23-3)9-15(13)21/h5-6,8,12,20H,4,7,9-11H2,1-3H3/b16-6- |
| InChIKey | ZUMGTVBHACMHLO-SOFYXZRVSA-N |
| XLogP | 2.89 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|