C23H36I2O — CID 144966406
1-(8,10-diiodo-3,6,13-trimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propan-1-one (PubChem CID 144966406) has the molecular formula C23H36I2O and a molecular weight of 582.35 g/mol. Its IUPAC name is 1-(8,10-diiodo-3,6,13-trimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propan-1-one.
| Compound Name | 1-(8,10-diiodo-3,6,13-trimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propan-1-one |
|---|---|
| PubChem CID | 144966406 |
| Molecular Formula | C23H36I2O |
| Molecular Weight | 582.35 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | 1-(8,10-diiodo-3,6,13-trimethyl-1,2,3,4,5,6,7,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)propan-1-one |
| SMILES | CCC(=O)C1CCC2C1(C)CCC1C3(I)CCC(C)CC3C(C)CC21I |
| InChI | InChI=1S/C23H36I2O/c1-5-18(26)16-6-7-19-21(16,4)10-9-20-22(24)11-8-14(2)12-17(22)15(3)13-23(19,20)25/h14-17,19-20H,5-13H2,1-4H3 |
| InChIKey | YTRSYNBFVUZSML-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.35 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|