About N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane
N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane (PubChem CID 144966687) has the molecular formula C25H29NO5
and a molecular weight of 423.51 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane.
Molecular Properties
| Compound Name | N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane |
| PubChem CID | 144966687 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane |
| SMILES | CC.O=C(c1cc(-c2ccc(O)cc2)cc(-c2ccc(O)cc2)c1)N(CCO)CCO |
| InChI | InChI=1S/C23H23NO5.C2H6/c25-11-9-24(10-12-26)23(29)20-14-18(16-1-5-21(27)6-2-16)13-19(15-20)17-3-7-22(28)8-4-17;1-2/h1-8,13-15,25-28H,9-12H2;1-2H3 |
| InChIKey | ZHNVROSVRNZMGG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane?
The IUPAC name of N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane (CID 144966687) is N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane.
What is the SMILES notation for N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane?
The canonical SMILES for N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane is CC.O=C(c1cc(-c2ccc(O)cc2)cc(-c2ccc(O)cc2)c1)N(CCO)CCO.
What is the InChIKey of N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane?
The InChIKey is ZHNVROSVRNZMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO5.C2H6/c25-11-9-24(10-12-26)23(29)20-14-18(16-1-5-21(27)6-2-16)13-19(15-20)17-3-7-22(28)8-4-17;1-2/h1-8,13-15,25-28H,9-12H2;1-2H3.
What are the key properties of N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane?
N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane has a molecular weight of 423.51 g/mol, XLogP of 3.88, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-hydroxyethyl)-3,5-bis(4-hydroxyphenyl)benzamide;ethane is sourced from PubChem (CID 144966687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).