C16H18O2 — CID 144967836
(8aR)-8a-ethenyl-3-methyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one (PubChem CID 144967836) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (8aR)-8a-ethenyl-3-methyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one.
| Compound Name | (8aR)-8a-ethenyl-3-methyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 144967836 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (8aR)-8a-ethenyl-3-methyl-5-methylidene-4a,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| SMILES | C=C[C@@]12C=C3OC(=O)C(C)=C3CC1C(=C)CCC2 |
| InChI | InChI=1S/C16H18O2/c1-4-16-7-5-6-10(2)13(16)8-12-11(3)15(17)18-14(12)9-16/h4,9,13H,1-2,5-8H2,3H3/t13?,16-/m1/s1 |
| InChIKey | OLAJVHQZKKWEBK-FQNRMIAFSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|