About 3-methylhexane;2-methyloxirane
3-methylhexane;2-methyloxirane (PubChem CID 144967859) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is 3-methylhexane;2-methyloxirane.
Molecular Properties
| Compound Name | 3-methylhexane;2-methyloxirane |
| PubChem CID | 144967859 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 3-methylhexane;2-methyloxirane |
| SMILES | CC1CO1.CCCC(C)CC |
| InChI | InChI=1S/C7H16.C3H6O/c1-4-6-7(3)5-2;1-3-2-4-3/h7H,4-6H2,1-3H3;3H,2H2,1H3 |
| InChIKey | IDBSGBAGXFTTGJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhexane;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexane;2-methyloxirane?
The IUPAC name of 3-methylhexane;2-methyloxirane (CID 144967859) is 3-methylhexane;2-methyloxirane.
What is the SMILES notation for 3-methylhexane;2-methyloxirane?
The canonical SMILES for 3-methylhexane;2-methyloxirane is CC1CO1.CCCC(C)CC.
What is the InChIKey of 3-methylhexane;2-methyloxirane?
The InChIKey is IDBSGBAGXFTTGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16.C3H6O/c1-4-6-7(3)5-2;1-3-2-4-3/h7H,4-6H2,1-3H3;3H,2H2,1H3.
What are the key properties of 3-methylhexane;2-methyloxirane?
3-methylhexane;2-methyloxirane has a molecular weight of 158.28 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexane;2-methyloxirane is sourced from PubChem (CID 144967859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).