About (2-bromo-4,6-dichlorophenoxy)-trimethylsilane
(2-bromo-4,6-dichlorophenoxy)-trimethylsilane (PubChem CID 14496882) has the molecular formula C9H11BrCl2OSi
and a molecular weight of 314.08 g/mol. Its IUPAC name is (2-bromo-4,6-dichlorophenoxy)-trimethylsilane.
Molecular Properties
| Compound Name | (2-bromo-4,6-dichlorophenoxy)-trimethylsilane |
| PubChem CID | 14496882 |
| Molecular Formula | C9H11BrCl2OSi |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 311.91 |
| IUPAC Name | (2-bromo-4,6-dichlorophenoxy)-trimethylsilane |
| SMILES | C[Si](C)(C)Oc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C9H11BrCl2OSi/c1-14(2,3)13-9-7(10)4-6(11)5-8(9)12/h4-5H,1-3H3 |
| InChIKey | RABZADINRAEICD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-4,6-dichlorophenoxy)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4,6-dichlorophenoxy)-trimethylsilane?
The IUPAC name of (2-bromo-4,6-dichlorophenoxy)-trimethylsilane (CID 14496882) is (2-bromo-4,6-dichlorophenoxy)-trimethylsilane.
What is the SMILES notation for (2-bromo-4,6-dichlorophenoxy)-trimethylsilane?
The canonical SMILES for (2-bromo-4,6-dichlorophenoxy)-trimethylsilane is C[Si](C)(C)Oc1c(Cl)cc(Cl)cc1Br.
What is the InChIKey of (2-bromo-4,6-dichlorophenoxy)-trimethylsilane?
The InChIKey is RABZADINRAEICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrCl2OSi/c1-14(2,3)13-9-7(10)4-6(11)5-8(9)12/h4-5H,1-3H3.
What are the key properties of (2-bromo-4,6-dichlorophenoxy)-trimethylsilane?
(2-bromo-4,6-dichlorophenoxy)-trimethylsilane has a molecular weight of 314.08 g/mol, XLogP of 4.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4,6-dichlorophenoxy)-trimethylsilane is sourced from PubChem (CID 14496882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).