C23H36ClN3O7S — CID 144970263
tert-butyl 2-[[[(E)-7-chloro-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyhept-4-enoyl]amino]methyl]-2,3-dihydro-1,3-thiazole-4-carboxylate (PubChem CID 144970263) has the molecular formula C23H36ClN3O7S and a molecular weight of 534.08 g/mol. Its IUPAC name is tert-butyl 2-[[[(E)-7-chloro-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyhept-4-enoyl]amino]methyl]-2,3-dihydro-1,3-thiazole-4-carboxylate.
| Compound Name | tert-butyl 2-[[[(E)-7-chloro-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyhept-4-enoyl]amino]methyl]-2,3-dihydro-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 144970263 |
| Molecular Formula | C23H36ClN3O7S |
| Molecular Weight | 534.08 g/mol |
| Exact Mass | 533.20 |
| IUPAC Name | tert-butyl 2-[[[(E)-7-chloro-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]oxyhept-4-enoyl]amino]methyl]-2,3-dihydro-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)OC(/C=C/CCCl)CC(=O)NCC1NC(C(=O)OC(C)(C)C)=CS1 |
| InChI | InChI=1S/C23H36ClN3O7S/c1-22(2,3)33-20(30)16-14-35-18(27-16)12-25-17(28)11-15(9-7-8-10-24)32-19(29)13-26-21(31)34-23(4,5)6/h7,9,14-15,18,27H,8,10-13H2,1-6H3,(H,25,28)(H,26,31)/b9-7+ |
| InChIKey | CHHDDPZMVORYLK-VQHVLOKHSA-N |
| XLogP | 2.96 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.08 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|