About 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane
2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane (PubChem CID 144970403) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane.
Molecular Properties
| Compound Name | 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane |
| PubChem CID | 144970403 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane |
| SMILES | CCC.CCc1cc(=O)n2cc(C)ccc2n1 |
| InChI | InChI=1S/C11H12N2O.C3H8/c1-3-9-6-11(14)13-7-8(2)4-5-10(13)12-9;1-3-2/h4-7H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | HWCRWPIZTLTEQE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane?
The IUPAC name of 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane (CID 144970403) is 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane.
What is the SMILES notation for 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane?
The canonical SMILES for 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane is CCC.CCc1cc(=O)n2cc(C)ccc2n1.
What is the InChIKey of 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane?
The InChIKey is HWCRWPIZTLTEQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O.C3H8/c1-3-9-6-11(14)13-7-8(2)4-5-10(13)12-9;1-3-2/h4-7H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane?
2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane has a molecular weight of 232.33 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-methylpyrido[1,2-a]pyrimidin-4-one;propane is sourced from PubChem (CID 144970403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).