C26H41N3O4 — CID 144970504
3-[[(2S)-2-amino-4-phenylbutanoyl]amino]-5-methyl-N-[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]hexanamide (PubChem CID 144970504) has the molecular formula C26H41N3O4 and a molecular weight of 459.63 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-phenylbutanoyl]amino]-5-methyl-N-[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]hexanamide.
| Compound Name | 3-[[(2S)-2-amino-4-phenylbutanoyl]amino]-5-methyl-N-[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]hexanamide |
|---|---|
| PubChem CID | 144970504 |
| Molecular Formula | C26H41N3O4 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.31 |
| IUPAC Name | 3-[[(2S)-2-amino-4-phenylbutanoyl]amino]-5-methyl-N-[4-methyl-1-(2-methyloxiran-2-yl)-1-oxopentan-2-yl]hexanamide |
| SMILES | CC(C)CC(CC(=O)NC(CC(C)C)C(=O)C1(C)CO1)NC(=O)[C@@H](N)CCc1ccccc1 |
| InChI | InChI=1S/C26H41N3O4/c1-17(2)13-20(28-25(32)21(27)12-11-19-9-7-6-8-10-19)15-23(30)29-22(14-18(3)4)24(31)26(5)16-33-26/h6-10,17-18,20-22H,11-16,27H2,1-5H3,(H,28,32)(H,29,30)/t20?,21-,22?,26?/m0/s1 |
| InChIKey | TZHKZKNBIHAHFU-XOSCFKQTSA-N |
| XLogP | 2.76 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|