About N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide
N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide (PubChem CID 144970726) has the molecular formula C13H18Cl2N2O4
and a molecular weight of 337.20 g/mol. Its IUPAC name is N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide.
Molecular Properties
| Compound Name | N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide |
| PubChem CID | 144970726 |
| Molecular Formula | C13H18Cl2N2O4 |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide |
| SMILES | CCC(=O)NC(CCC(Cl)Cl)C(=O)N1CC(OC)=CC1=O |
| InChI | InChI=1S/C13H18Cl2N2O4/c1-3-11(18)16-9(4-5-10(14)15)13(20)17-7-8(21-2)6-12(17)19/h6,9-10H,3-5,7H2,1-2H3,(H,16,18) |
| InChIKey | GOPSQEIDSRQGSB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide?
The IUPAC name of N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide (CID 144970726) is N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide.
What is the SMILES notation for N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide?
The canonical SMILES for N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide is CCC(=O)NC(CCC(Cl)Cl)C(=O)N1CC(OC)=CC1=O.
What is the InChIKey of N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide?
The InChIKey is GOPSQEIDSRQGSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N2O4/c1-3-11(18)16-9(4-5-10(14)15)13(20)17-7-8(21-2)6-12(17)19/h6,9-10H,3-5,7H2,1-2H3,(H,16,18).
What are the key properties of N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide?
N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide has a molecular weight of 337.20 g/mol, XLogP of 1.36, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5,5-dichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]propanamide is sourced from PubChem (CID 144970726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).