C15H17Cl3N2O4 — CID 144970733
N-[5,5,5-trichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]pent-4-ynamide (PubChem CID 144970733) has the molecular formula C15H17Cl3N2O4 and a molecular weight of 395.67 g/mol. Its IUPAC name is N-[5,5,5-trichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]pent-4-ynamide.
| Compound Name | N-[5,5,5-trichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]pent-4-ynamide |
|---|---|
| PubChem CID | 144970733 |
| Molecular Formula | C15H17Cl3N2O4 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | N-[5,5,5-trichloro-1-(3-methoxy-5-oxo-2H-pyrrol-1-yl)-1-oxopentan-2-yl]pent-4-ynamide |
| SMILES | C#CCCC(=O)NC(CCC(Cl)(Cl)Cl)C(=O)N1CC(OC)=CC1=O |
| InChI | InChI=1S/C15H17Cl3N2O4/c1-3-4-5-12(21)19-11(6-7-15(16,17)18)14(23)20-9-10(24-2)8-13(20)22/h1,8,11H,4-7,9H2,2H3,(H,19,21) |
| InChIKey | LRDGZLLVXOIDMP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|